C21H19NO8 — CID 90097599
[2-(6-carboxyoxy-5,7-dioxocyclopenta[b]pyridin-6-yl)-5-propan-2-ylphenyl] ethyl carbonate (PubChem CID 90097599) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is [2-(6-carboxyoxy-5,7-dioxocyclopenta[b]pyridin-6-yl)-5-propan-2-ylphenyl] ethyl carbonate.
| Compound Name | [2-(6-carboxyoxy-5,7-dioxocyclopenta[b]pyridin-6-yl)-5-propan-2-ylphenyl] ethyl carbonate |
|---|---|
| PubChem CID | 90097599 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-(6-carboxyoxy-5,7-dioxocyclopenta[b]pyridin-6-yl)-5-propan-2-ylphenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(C(C)C)ccc1C1(OC(=O)O)C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C21H19NO8/c1-4-28-20(27)29-15-10-12(11(2)3)7-8-14(15)21(30-19(25)26)17(23)13-6-5-9-22-16(13)18(21)24/h5-11H,4H2,1-3H3,(H,25,26) |
| InChIKey | RBNQRFBWLYUPKI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|