C28H34FeN2O5 — CID 159565640
[2-[4-amino-1,3-dioxo-2-(pentanoylamino)inden-2-yl]-5-propan-2-ylphenyl] pentanoate;iron (PubChem CID 159565640) has the molecular formula C28H34FeN2O5 and a molecular weight of 534.43 g/mol. Its IUPAC name is [2-[4-amino-1,3-dioxo-2-(pentanoylamino)inden-2-yl]-5-propan-2-ylphenyl] pentanoate;iron.
| Compound Name | [2-[4-amino-1,3-dioxo-2-(pentanoylamino)inden-2-yl]-5-propan-2-ylphenyl] pentanoate;iron |
|---|---|
| PubChem CID | 159565640 |
| Molecular Formula | C28H34FeN2O5 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [2-[4-amino-1,3-dioxo-2-(pentanoylamino)inden-2-yl]-5-propan-2-ylphenyl] pentanoate;iron |
| SMILES | CCCCC(=O)NC1(c2ccc(C(C)C)cc2OC(=O)CCCC)C(=O)c2cccc(N)c2C1=O.[Fe] |
| InChI | InChI=1S/C28H34N2O5.Fe/c1-5-7-12-23(31)30-28(26(33)19-10-9-11-21(29)25(19)27(28)34)20-15-14-18(17(3)4)16-22(20)35-24(32)13-8-6-2;/h9-11,14-17H,5-8,12-13,29H2,1-4H3,(H,30,31); |
| InChIKey | MHDWKDVYDIKLNA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|