About [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate
[1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate (PubChem CID 138662068) has the molecular formula C23H26N2O4
and a molecular weight of 394.47 g/mol. Its IUPAC name is [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate.
Molecular Properties
| Compound Name | [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate |
| PubChem CID | 138662068 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate |
| SMILES | CCCC(=O)OC12Oc3cc(C(C)C)ccc3C1(NC)C(=O)c1c(N)cccc12 |
| InChI | InChI=1S/C23H26N2O4/c1-5-7-19(26)29-23-16-8-6-9-17(24)20(16)21(27)22(23,25-4)15-11-10-14(13(2)3)12-18(15)28-23/h6,8-13,25H,5,7,24H2,1-4H3 |
| InChIKey | UUVZONCLFASHNL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate?
The IUPAC name of [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate (CID 138662068) is [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate.
What is the SMILES notation for [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate?
The canonical SMILES for [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate is CCCC(=O)OC12Oc3cc(C(C)C)ccc3C1(NC)C(=O)c1c(N)cccc12.
What is the InChIKey of [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate?
The InChIKey is UUVZONCLFASHNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O4/c1-5-7-19(26)29-23-16-8-6-9-17(24)20(16)21(27)22(23,25-4)15-11-10-14(13(2)3)12-18(15)28-23/h6,8-13,25H,5,7,24H2,1-4H3.
What are the key properties of [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate?
[1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate has a molecular weight of 394.47 g/mol, XLogP of 3.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-9b-(methylamino)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-4b-yl] butanoate is sourced from PubChem (CID 138662068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).