C30H40N2O5 — CID 134250429
N-[1-amino-4b-(1-hydroxyhexoxy)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl]hexanamide (PubChem CID 134250429) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[1-amino-4b-(1-hydroxyhexoxy)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl]hexanamide.
| Compound Name | N-[1-amino-4b-(1-hydroxyhexoxy)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl]hexanamide |
|---|---|
| PubChem CID | 134250429 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[1-amino-4b-(1-hydroxyhexoxy)-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl]hexanamide |
| SMILES | CCCCCC(=O)NC12C(=O)c3c(N)cccc3C1(OC(O)CCCCC)Oc1cc(C(C)C)ccc12 |
| InChI | InChI=1S/C30H40N2O5/c1-5-7-9-14-25(33)32-29-21-17-16-20(19(3)4)18-24(21)36-30(29,37-26(34)15-10-8-6-2)22-12-11-13-23(31)27(22)28(29)35/h11-13,16-19,26,34H,5-10,14-15,31H2,1-4H3,(H,32,33) |
| InChIKey | JINXKOXYCISUJE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|