C30H37NO5 — CID 172692431
2-[2-[2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid (PubChem CID 172692431) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[2-[2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid.
| Compound Name | 2-[2-[2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid |
|---|---|
| PubChem CID | 172692431 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-[2-[2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid |
| SMILES | CCCCCC(=O)NC1(c2ccc(C(C)C)cc2C(CCCC)C(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H37NO5/c1-5-7-9-15-26(32)31-30(27(33)21-13-10-11-14-22(21)28(30)34)25-17-16-20(19(3)4)18-24(25)23(29(35)36)12-8-6-2/h10-11,13-14,16-19,23H,5-9,12,15H2,1-4H3,(H,31,32)(H,35,36) |
| InChIKey | BWAAGCYORPZSGI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|