C30H38N2O5 — CID 172683750
2-[2-[4-amino-2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid (PubChem CID 172683750) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[2-[4-amino-2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid.
| Compound Name | 2-[2-[4-amino-2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid |
|---|---|
| PubChem CID | 172683750 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 2-[2-[4-amino-2-(hexanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]hexanoic acid |
| SMILES | CCCCCC(=O)NC1(c2ccc(C(C)C)cc2C(CCCC)C(=O)O)C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C30H38N2O5/c1-5-7-9-14-25(33)32-30(27(34)21-12-10-13-24(31)26(21)28(30)35)23-16-15-19(18(3)4)17-22(23)20(29(36)37)11-8-6-2/h10,12-13,15-18,20H,5-9,11,14,31H2,1-4H3,(H,32,33)(H,36,37) |
| InChIKey | ATGKIEGZUMMLKE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|