C32H42N2O5 — CID 172857555
2-[2-[4-amino-2-(heptanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]heptanoic acid (PubChem CID 172857555) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is 2-[2-[4-amino-2-(heptanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]heptanoic acid.
| Compound Name | 2-[2-[4-amino-2-(heptanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]heptanoic acid |
|---|---|
| PubChem CID | 172857555 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 2-[2-[4-amino-2-(heptanoylamino)-1,3-dioxoinden-2-yl]-5-propan-2-ylphenyl]heptanoic acid |
| SMILES | CCCCCCC(=O)NC1(c2ccc(C(C)C)cc2C(CCCCC)C(=O)O)C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C32H42N2O5/c1-5-7-9-11-16-27(35)34-32(29(36)23-14-12-15-26(33)28(23)30(32)37)25-18-17-21(20(3)4)19-24(25)22(31(38)39)13-10-8-6-2/h12,14-15,17-20,22H,5-11,13,16,33H2,1-4H3,(H,34,35)(H,38,39) |
| InChIKey | YXMGPCZYJVEHNQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|