C29H35NO5 — CID 138714422
[2-[1,4-dioxo-2-(pentanoylamino)-3H-naphthalen-2-yl]-5-propan-2-ylphenyl] 2,2-dimethylpropanoate (PubChem CID 138714422) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is [2-[1,4-dioxo-2-(pentanoylamino)-3H-naphthalen-2-yl]-5-propan-2-ylphenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[1,4-dioxo-2-(pentanoylamino)-3H-naphthalen-2-yl]-5-propan-2-ylphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138714422 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [2-[1,4-dioxo-2-(pentanoylamino)-3H-naphthalen-2-yl]-5-propan-2-ylphenyl] 2,2-dimethylpropanoate |
| SMILES | CCCCC(=O)NC1(c2ccc(C(C)C)cc2OC(=O)C(C)(C)C)CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H35NO5/c1-7-8-13-25(32)30-29(17-23(31)20-11-9-10-12-21(20)26(29)33)22-15-14-19(18(2)3)16-24(22)35-27(34)28(4,5)6/h9-12,14-16,18H,7-8,13,17H2,1-6H3,(H,30,32) |
| InChIKey | ZSNSBJGBVAGWMG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|