C25H21ClN2O4 — CID 151038554
2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-4-chlorobenzamide (PubChem CID 151038554) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-4-chlorobenzamide.
| Compound Name | 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 151038554 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-4-chlorobenzamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21c1cc(Cl)ccc1C(N)=O |
| InChI | InChI=1S/C25H21ClN2O4/c1-12(2)13-6-9-16-20(10-13)32-25(31)17-4-3-5-19(27)21(17)22(29)24(16,25)18-11-14(26)7-8-15(18)23(28)30/h3-12,31H,27H2,1-2H3,(H2,28,30) |
| InChIKey | MBPANFSIRHAKPN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|