C6H7FN2 — CID 141356719
6-fluoro-2-methyl-1H-1,4-diazepine (PubChem CID 141356719) has the molecular formula C6H7FN2 and a molecular weight of 126.13 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1H-1,4-diazepine.
| Compound Name | 6-fluoro-2-methyl-1H-1,4-diazepine |
|---|---|
| PubChem CID | 141356719 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 6-fluoro-2-methyl-1H-1,4-diazepine |
| SMILES | CC1=CN=CC(F)=CN1 |
| InChI | InChI=1S/C6H7FN2/c1-5-2-8-3-6(7)4-9-5/h2-4,9H,1H3 |
| InChIKey | IOMSAUBMXQSVMF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |