C6H6O4 — CID 141356839
4-(ethenoxymethyl)-1,3-dioxol-2-one (PubChem CID 141356839) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is 4-(ethenoxymethyl)-1,3-dioxol-2-one.
| Compound Name | 4-(ethenoxymethyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 141356839 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 4-(ethenoxymethyl)-1,3-dioxol-2-one |
| SMILES | C=COCc1coc(=O)o1 |
| InChI | InChI=1S/C6H6O4/c1-2-8-3-5-4-9-6(7)10-5/h2,4H,1,3H2 |
| InChIKey | MFKSOGMGFCXXPH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|