C5H4F2O4 — CID 153312380
4-(difluoromethoxymethyl)-1,3-dioxol-2-one (PubChem CID 153312380) has the molecular formula C5H4F2O4 and a molecular weight of 166.08 g/mol. Its IUPAC name is 4-(difluoromethoxymethyl)-1,3-dioxol-2-one.
| Compound Name | 4-(difluoromethoxymethyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312380 |
| Molecular Formula | C5H4F2O4 |
| Molecular Weight | 166.08 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 4-(difluoromethoxymethyl)-1,3-dioxol-2-one |
| SMILES | O=c1occ(COC(F)F)o1 |
| InChI | InChI=1S/C5H4F2O4/c6-4(7)9-1-3-2-10-5(8)11-3/h2,4H,1H2 |
| InChIKey | NJYJVQCGNQYRRI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.08 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |