C10H10F6O5 — CID 153312356
4-[[2,2-difluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one (PubChem CID 153312356) has the molecular formula C10H10F6O5 and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-[[2,2-difluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[2,2-difluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312356 |
| Molecular Formula | C10H10F6O5 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-[[2,2-difluoro-3-(1,1,2,2-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
| SMILES | CC(F)(F)C(F)(F)OCC(F)(F)COCc1coc(=O)o1 |
| InChI | InChI=1S/C10H10F6O5/c1-8(11,12)10(15,16)20-5-9(13,14)4-18-2-6-3-19-7(17)21-6/h3H,2,4-5H2,1H3 |
| InChIKey | MAHIIBSYUFGMLN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|