C9H6F8O4 — CID 153312364
4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)-1,3-dioxol-2-one (PubChem CID 153312364) has the molecular formula C9H6F8O4 and a molecular weight of 330.13 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)-1,3-dioxol-2-one.
| Compound Name | 4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312364 |
| Molecular Formula | C9H6F8O4 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)-1,3-dioxol-2-one |
| SMILES | O=c1occ(COCC(F)(F)C(F)(F)C(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C9H6F8O4/c10-5(11)8(14,15)9(16,17)7(12,13)3-19-1-4-2-20-6(18)21-4/h2,5H,1,3H2 |
| InChIKey | LZMBTNUUZLUZMM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|