C10H8F8O5 — CID 153312365
4-[[2,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one (PubChem CID 153312365) has the molecular formula C10H8F8O5 and a molecular weight of 360.15 g/mol. Its IUPAC name is 4-[[2,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[2,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312365 |
| Molecular Formula | C10H8F8O5 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4-[[2,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
| SMILES | O=c1occ(COCC(F)(OCC(F)(F)C(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H8F8O5/c11-6(12)8(13,14)3-22-9(15,10(16,17)18)4-20-1-5-2-21-7(19)23-5/h2,6H,1,3-4H2 |
| InChIKey | XQSFDYNHBDTAOT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|