C7H6F4O4 — CID 153312354
4-(1,1,2,2-tetrafluoropropoxymethyl)-1,3-dioxol-2-one (PubChem CID 153312354) has the molecular formula C7H6F4O4 and a molecular weight of 230.11 g/mol. Its IUPAC name is 4-(1,1,2,2-tetrafluoropropoxymethyl)-1,3-dioxol-2-one.
| Compound Name | 4-(1,1,2,2-tetrafluoropropoxymethyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312354 |
| Molecular Formula | C7H6F4O4 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 4-(1,1,2,2-tetrafluoropropoxymethyl)-1,3-dioxol-2-one |
| SMILES | CC(F)(F)C(F)(F)OCc1coc(=O)o1 |
| InChI | InChI=1S/C7H6F4O4/c1-6(8,9)7(10,11)14-3-4-2-13-5(12)15-4/h2H,3H2,1H3 |
| InChIKey | NXWMNWVMJDNHAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|