C8H3F9O4 — CID 153312357
4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,3-dioxol-2-one (PubChem CID 153312357) has the molecular formula C8H3F9O4 and a molecular weight of 334.09 g/mol. Its IUPAC name is 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312357 |
| Molecular Formula | C8H3F9O4 |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,3-dioxol-2-one |
| SMILES | O=c1occ(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C8H3F9O4/c9-6(10,11)5(7(12,13)14,8(15,16)17)20-2-3-1-19-4(18)21-3/h1H,2H2 |
| InChIKey | OVBZSQHVGNGCQA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |