C10H6F10O5 — CID 153312381
4-[[2,3,3,3-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one (PubChem CID 153312381) has the molecular formula C10H6F10O5 and a molecular weight of 396.13 g/mol. Its IUPAC name is 4-[[2,3,3,3-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[2,3,3,3-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312381 |
| Molecular Formula | C10H6F10O5 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 4-[[2,3,3,3-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one |
| SMILES | O=c1occ(COCC(F)(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H6F10O5/c11-7(10(18,19)20,3-22-1-4-2-23-6(21)24-4)25-5(8(12,13)14)9(15,16)17/h2,5H,1,3H2 |
| InChIKey | OZAMRWRWNPVBRJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |