C10H5F11O5 — CID 153312372
4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one (PubChem CID 153312372) has the molecular formula C10H5F11O5 and a molecular weight of 414.12 g/mol. Its IUPAC name is 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312372 |
| Molecular Formula | C10H5F11O5 |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-[[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]methyl]-1,3-dioxol-2-one |
| SMILES | O=c1occ(COCC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H5F11O5/c11-6(8(14,15)16,3-23-1-4-2-24-5(22)25-4)26-10(20,21)7(12,13)9(17,18)19/h2H,1,3H2 |
| InChIKey | BNEZRKJFRNXRGQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|