C12H7Cl3O5S — CID 141360139
(2,3-dichloro-4-hydroxyphenyl) 5-chloro-2-hydroxybenzenesulfonate (PubChem CID 141360139) has the molecular formula C12H7Cl3O5S and a molecular weight of 369.61 g/mol. Its IUPAC name is (2,3-dichloro-4-hydroxyphenyl) 5-chloro-2-hydroxybenzenesulfonate.
| Compound Name | (2,3-dichloro-4-hydroxyphenyl) 5-chloro-2-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 141360139 |
| Molecular Formula | C12H7Cl3O5S |
| Molecular Weight | 369.61 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | (2,3-dichloro-4-hydroxyphenyl) 5-chloro-2-hydroxybenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(O)c(Cl)c1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H7Cl3O5S/c13-6-1-2-7(16)10(5-6)21(18,19)20-9-4-3-8(17)11(14)12(9)15/h1-5,16-17H |
| InChIKey | XDIHMZUZWWXSLJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|