C19H28O4 — CID 141360219
(5S,8R,9S,10S,13S,14S)-10-methyl-13-(trihydroxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 141360219) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S)-10-methyl-13-(trihydroxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8R,9S,10S,13S,14S)-10-methyl-13-(trihydroxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141360219 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S)-10-methyl-13-(trihydroxymethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C(O)(O)O)C=CC[C@@H]12 |
| InChI | InChI=1S/C19H28O4/c1-17-9-6-13(20)11-12(17)4-5-14-15(17)7-10-18(19(21,22)23)8-2-3-16(14)18/h2,8,12,14-16,21-23H,3-7,9-11H2,1H3/t12-,14+,15-,16-,17-,18+/m0/s1 |
| InChIKey | DTVVIOJOJQFMDU-TVIGFCDGSA-N |
| XLogP | 2.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|