C20H30O — CID 141366706
(5S,8R,9S,10S,13R,14S)-13-ethyl-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 141366706) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (5S,8R,9S,10S,13R,14S)-13-ethyl-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8R,9S,10S,13R,14S)-13-ethyl-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141366706 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (5S,8R,9S,10S,13R,14S)-13-ethyl-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@@]12C=CC[C@H]1[C@@H]1CC[C@H]3CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H30O/c1-3-20-10-4-5-18(20)16-7-6-14-13-15(21)8-11-19(14,2)17(16)9-12-20/h4,10,14,16-18H,3,5-9,11-13H2,1-2H3/t14-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | OHGXETIRMRVGSG-PYNNRZRQSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|