C16H13F2N3O2S — CID 141360450
2-[3-fluoro-2-(2-fluoro-3-pyridinyl)pyrrol-1-yl]sulfonyl-4,5-dimethylpyridine (PubChem CID 141360450) has the molecular formula C16H13F2N3O2S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-[3-fluoro-2-(2-fluoro-3-pyridinyl)pyrrol-1-yl]sulfonyl-4,5-dimethylpyridine.
| Compound Name | 2-[3-fluoro-2-(2-fluoro-3-pyridinyl)pyrrol-1-yl]sulfonyl-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 141360450 |
| Molecular Formula | C16H13F2N3O2S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[3-fluoro-2-(2-fluoro-3-pyridinyl)pyrrol-1-yl]sulfonyl-4,5-dimethylpyridine |
| SMILES | Cc1cnc(S(=O)(=O)n2ccc(F)c2-c2cccnc2F)cc1C |
| InChI | InChI=1S/C16H13F2N3O2S/c1-10-8-14(20-9-11(10)2)24(22,23)21-7-5-13(17)15(21)12-4-3-6-19-16(12)18/h3-9H,1-2H3 |
| InChIKey | NQMYDLHMLHGVQW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|