C16H15N3O — CID 141360565
2-(1-aminoethyl)-6-phenyl-1,6-naphthyridin-5-one (PubChem CID 141360565) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(1-aminoethyl)-6-phenyl-1,6-naphthyridin-5-one.
| Compound Name | 2-(1-aminoethyl)-6-phenyl-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 141360565 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(1-aminoethyl)-6-phenyl-1,6-naphthyridin-5-one |
| SMILES | CC(N)c1ccc2c(=O)n(-c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C16H15N3O/c1-11(17)14-8-7-13-15(18-14)9-10-19(16(13)20)12-5-3-2-4-6-12/h2-11H,17H2,1H3 |
| InChIKey | MMNRYJDPGSOXNK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |