C19H30O2 — CID 141361132
1,2-dicyclopentyl-5,5-bis(methoxymethyl)cyclopenta-1,3-diene (PubChem CID 141361132) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1,2-dicyclopentyl-5,5-bis(methoxymethyl)cyclopenta-1,3-diene.
| Compound Name | 1,2-dicyclopentyl-5,5-bis(methoxymethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 141361132 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1,2-dicyclopentyl-5,5-bis(methoxymethyl)cyclopenta-1,3-diene |
| SMILES | COCC1(COC)C=CC(C2CCCC2)=C1C1CCCC1 |
| InChI | InChI=1S/C19H30O2/c1-20-13-19(14-21-2)12-11-17(15-7-3-4-8-15)18(19)16-9-5-6-10-16/h11-12,15-16H,3-10,13-14H2,1-2H3 |
| InChIKey | LJFDNMVGTKKACR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |