C26H22N4 — CID 141362054
2-[2-[4-(3H-benzimidazol-5-yl)-1,3-dihydroisoindol-2-yl]ethyl]quinoline (PubChem CID 141362054) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[2-[4-(3H-benzimidazol-5-yl)-1,3-dihydroisoindol-2-yl]ethyl]quinoline.
| Compound Name | 2-[2-[4-(3H-benzimidazol-5-yl)-1,3-dihydroisoindol-2-yl]ethyl]quinoline |
|---|---|
| PubChem CID | 141362054 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[2-[4-(3H-benzimidazol-5-yl)-1,3-dihydroisoindol-2-yl]ethyl]quinoline |
| SMILES | c1cc2c(c(-c3ccc4nc[nH]c4c3)c1)CN(CCc1ccc3ccccc3n1)C2 |
| InChI | InChI=1S/C26H22N4/c1-2-7-24-18(4-1)8-10-21(29-24)12-13-30-15-20-5-3-6-22(23(20)16-30)19-9-11-25-26(14-19)28-17-27-25/h1-11,14,17H,12-13,15-16H2,(H,27,28) |
| InChIKey | ZAENRNYAPJBILZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |