C25H42N2O — CID 141362970
(E,8S,9S,10R,13S,14S)-4,4,10,13-tetramethyl-N-[(3R)-pyrrolidin-3-yl]oxy-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine (PubChem CID 141362970) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is (E,8S,9S,10R,13S,14S)-4,4,10,13-tetramethyl-N-[(3R)-pyrrolidin-3-yl]oxy-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine.
| Compound Name | (E,8S,9S,10R,13S,14S)-4,4,10,13-tetramethyl-N-[(3R)-pyrrolidin-3-yl]oxy-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 141362970 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | (E,8S,9S,10R,13S,14S)-4,4,10,13-tetramethyl-N-[(3R)-pyrrolidin-3-yl]oxy-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
| SMILES | CC1(C)/C(=N/O[C@@H]2CCNC2)CC[C@@]2(C)C1CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H42N2O/c1-23(2)21-8-7-18-19-6-5-12-24(19,3)13-9-20(18)25(21,4)14-10-22(23)27-28-17-11-15-26-16-17/h17-21,26H,5-16H2,1-4H3/b27-22+/t17-,18+,19+,20+,21?,24+,25-/m1/s1 |
| InChIKey | BGPDJJQFGKICMP-OETSDMBFSA-N |
| XLogP | 5.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|