C23H38N2O3 — CID 87655883
(3E,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[(3R)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-6,17-diol (PubChem CID 87655883) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (3E,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[(3R)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-6,17-diol.
| Compound Name | (3E,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[(3R)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-6,17-diol |
|---|---|
| PubChem CID | 87655883 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (3E,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[(3R)-pyrrolidin-3-yl]oxyimino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-6,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@H](O)C4C/C(=N/O[C@@H]5CCNC5)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C23H38N2O3/c1-22-8-5-14(25-28-15-7-10-24-13-15)11-19(22)20(26)12-16-17-3-4-21(27)23(17,2)9-6-18(16)22/h15-21,24,26-27H,3-13H2,1-2H3/b25-14+/t15-,16+,17+,18+,19?,20+,21+,22-,23+/m1/s1 |
| InChIKey | VMNIZZOYCUPQCG-MDYCMYRQSA-N |
| XLogP | 3.10 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|