C8H11F3N2O — CID 141365200
(2R)-1,1,1-trifluoro-2-methyl-4-(1H-pyrazol-5-yl)butan-2-ol (PubChem CID 141365200) has the molecular formula C8H11F3N2O and a molecular weight of 208.18 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-methyl-4-(1H-pyrazol-5-yl)butan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-methyl-4-(1H-pyrazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 141365200 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-methyl-4-(1H-pyrazol-5-yl)butan-2-ol |
| SMILES | C[C@@](O)(CCc1ccn[nH]1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O/c1-7(14,8(9,10)11)4-2-6-3-5-12-13-6/h3,5,14H,2,4H2,1H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | ZIMIHFKOLVVAGP-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |