C24H36O6 — CID 141365621
1-[2,2-bis(2-prop-2-enoyloxypropyl)cyclohexyl]propan-2-yl prop-2-enoate (PubChem CID 141365621) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[2,2-bis(2-prop-2-enoyloxypropyl)cyclohexyl]propan-2-yl prop-2-enoate.
| Compound Name | 1-[2,2-bis(2-prop-2-enoyloxypropyl)cyclohexyl]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 141365621 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-[2,2-bis(2-prop-2-enoyloxypropyl)cyclohexyl]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CC1CCCCC1(CC(C)OC(=O)C=C)CC(C)OC(=O)C=C |
| InChI | InChI=1S/C24H36O6/c1-7-21(25)28-17(4)14-20-12-10-11-13-24(20,15-18(5)29-22(26)8-2)16-19(6)30-23(27)9-3/h7-9,17-20H,1-3,10-16H2,4-6H3 |
| InChIKey | VVVUDRFPNDFBHA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|