About 2-phenylpropaneselenal
2-phenylpropaneselenal (PubChem CID 141365712) has the molecular formula C9H10Se
and a molecular weight of 197.14 g/mol. Its IUPAC name is 2-phenylpropaneselenal.
Molecular Properties
| Compound Name | 2-phenylpropaneselenal |
| PubChem CID | 141365712 |
| Molecular Formula | C9H10Se |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2-phenylpropaneselenal |
| SMILES | CC(C=[Se])c1ccccc1 |
| InChI | InChI=1S/C9H10Se/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | WOMYSLUQVLAZNP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropaneselenal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropaneselenal?
The IUPAC name of 2-phenylpropaneselenal (CID 141365712) is 2-phenylpropaneselenal.
What is the SMILES notation for 2-phenylpropaneselenal?
The canonical SMILES for 2-phenylpropaneselenal is CC(C=[Se])c1ccccc1.
What is the InChIKey of 2-phenylpropaneselenal?
The InChIKey is WOMYSLUQVLAZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Se/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3.
What are the key properties of 2-phenylpropaneselenal?
2-phenylpropaneselenal has a molecular weight of 197.14 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropaneselenal is sourced from PubChem (CID 141365712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).