C18H16ClN5O2 — CID 141365960
6-(6-chloro-3-nitro-2-pyridinyl)-4-piperidin-1-yl-1,7-naphthyridine (PubChem CID 141365960) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 6-(6-chloro-3-nitro-2-pyridinyl)-4-piperidin-1-yl-1,7-naphthyridine.
| Compound Name | 6-(6-chloro-3-nitro-2-pyridinyl)-4-piperidin-1-yl-1,7-naphthyridine |
|---|---|
| PubChem CID | 141365960 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 6-(6-chloro-3-nitro-2-pyridinyl)-4-piperidin-1-yl-1,7-naphthyridine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1-c1cc2c(N3CCCCC3)ccnc2cn1 |
| InChI | InChI=1S/C18H16ClN5O2/c19-17-5-4-16(24(25)26)18(22-17)13-10-12-14(11-21-13)20-7-6-15(12)23-8-2-1-3-9-23/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | PGKAHNARPUITTR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|