C12H12N4 — CID 141367996
7-cyclopentylpyrrolo[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 141367996) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 7-cyclopentylpyrrolo[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 7-cyclopentylpyrrolo[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 141367996 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 7-cyclopentylpyrrolo[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1cc2cncnc2n1C1CCCC1 |
| InChI | InChI=1S/C12H12N4/c13-6-11-5-9-7-14-8-15-12(9)16(11)10-3-1-2-4-10/h5,7-8,10H,1-4H2 |
| InChIKey | APWCVOFWTYAIHI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |