About 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine
7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine (PubChem CID 149286062) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine.
Molecular Properties
| Compound Name | 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine |
| PubChem CID | 149286062 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine |
| SMILES | c1ncc2cc3n(c2n1)CCC3 |
| InChI | InChI=1S/C9H9N3/c1-2-8-4-7-5-10-6-11-9(7)12(8)3-1/h4-6H,1-3H2 |
| InChIKey | XTXMCLXKBMSAHT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine?
The IUPAC name of 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine (CID 149286062) is 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine.
What is the SMILES notation for 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine?
The canonical SMILES for 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine is c1ncc2cc3n(c2n1)CCC3.
What is the InChIKey of 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine?
The InChIKey is XTXMCLXKBMSAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-2-8-4-7-5-10-6-11-9(7)12(8)3-1/h4-6H,1-3H2.
What are the key properties of 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine?
7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine has a molecular weight of 159.19 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizine is sourced from PubChem (CID 149286062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).