About 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one
6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 175780859) has the molecular formula C8H6BrN3O
and a molecular weight of 240.06 g/mol. Its IUPAC name is 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 175780859 |
| Molecular Formula | C8H6BrN3O |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(Br)cc2cncnc21 |
| InChI | InChI=1S/C8H6BrN3O/c1-12-7-5(3-10-4-11-7)2-6(9)8(12)13/h2-4H,1H3 |
| InChIKey | NADSVMZPOUDQGC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one (CID 175780859) is 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one is Cn1c(=O)c(Br)cc2cncnc21.
What is the InChIKey of 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is NADSVMZPOUDQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O/c1-12-7-5(3-10-4-11-7)2-6(9)8(12)13/h2-4H,1H3.
What are the key properties of 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one?
6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 240.06 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-methylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 175780859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).