C12H14N2O2S — CID 141206981
4-methylsulfonyl-6,7,8,9-tetrahydropyrido[3,2-b]indolizine (PubChem CID 141206981) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-methylsulfonyl-6,7,8,9-tetrahydropyrido[3,2-b]indolizine.
| Compound Name | 4-methylsulfonyl-6,7,8,9-tetrahydropyrido[3,2-b]indolizine |
|---|---|
| PubChem CID | 141206981 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-methylsulfonyl-6,7,8,9-tetrahydropyrido[3,2-b]indolizine |
| SMILES | CS(=O)(=O)c1ccnc2c1cc1n2CCCC1 |
| InChI | InChI=1S/C12H14N2O2S/c1-17(15,16)11-5-6-13-12-10(11)8-9-4-2-3-7-14(9)12/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | SANDFDISVWXJHD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |