C11H12N2OS — CID 123171177
2-sulfanyl-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-1-one (PubChem CID 123171177) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-sulfanyl-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-1-one.
| Compound Name | 2-sulfanyl-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-1-one |
|---|---|
| PubChem CID | 123171177 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-sulfanyl-6,7,8,9-tetrahydropyrido[3,4-b]indolizin-1-one |
| SMILES | O=c1c2cc3n(c2ccn1S)CCCC3 |
| InChI | InChI=1S/C11H12N2OS/c14-11-9-7-8-3-1-2-5-12(8)10(9)4-6-13(11)15/h4,6-7,15H,1-3,5H2 |
| InChIKey | FUBXUMPXFJDHMG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|