C14H11NO2 — CID 71768277
8-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,15-pentaen-9-one (PubChem CID 71768277) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 8-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,15-pentaen-9-one.
| Compound Name | 8-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,15-pentaen-9-one |
|---|---|
| PubChem CID | 71768277 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 8-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,15-pentaen-9-one |
| SMILES | O=c1oc2ccccc2c2cc3n(c12)CCC3 |
| InChI | InChI=1S/C14H11NO2/c16-14-13-11(8-9-4-3-7-15(9)13)10-5-1-2-6-12(10)17-14/h1-2,5-6,8H,3-4,7H2 |
| InChIKey | LBNOOTYCINPCNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|