C11H12N2 — CID 105435216
2,3-dihydro-1H-pyrrolo[1,2-a]indol-7-amine (PubChem CID 105435216) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[1,2-a]indol-7-amine.
| Compound Name | 2,3-dihydro-1H-pyrrolo[1,2-a]indol-7-amine |
|---|---|
| PubChem CID | 105435216 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[1,2-a]indol-7-amine |
| SMILES | Nc1ccc2cc3n(c2c1)CCC3 |
| InChI | InChI=1S/C11H12N2/c12-9-4-3-8-6-10-2-1-5-13(10)11(8)7-9/h3-4,6-7H,1-2,5,12H2 |
| InChIKey | MBOGMWFBWPFLEP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|