C20H19N3 — CID 177474250
4-(5-imino-7-phenyl-2,3-dihydro-1H-indolizin-6-yl)aniline (PubChem CID 177474250) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(5-imino-7-phenyl-2,3-dihydro-1H-indolizin-6-yl)aniline.
| Compound Name | 4-(5-imino-7-phenyl-2,3-dihydro-1H-indolizin-6-yl)aniline |
|---|---|
| PubChem CID | 177474250 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 4-(5-imino-7-phenyl-2,3-dihydro-1H-indolizin-6-yl)aniline |
| SMILES | [H]/N=c1/c(-c2ccc(N)cc2)c(-c2ccccc2)cc2n1CCC2 |
| InChI | InChI=1S/C20H19N3/c21-16-10-8-15(9-11-16)19-18(14-5-2-1-3-6-14)13-17-7-4-12-23(17)20(19)22/h1-3,5-6,8-11,13,22H,4,7,12,21H2/b22-20- |
| InChIKey | PIJNCFZWPWTHBN-XDOYNYLZSA-N |
| XLogP | 3.83 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|