C25H18N4O — CID 141368428
N-(4-benzo[i][1,5]benzodiazepin-1-ylphenyl)pyridine-3-carboxamide (PubChem CID 141368428) has the molecular formula C25H18N4O and a molecular weight of 390.45 g/mol. Its IUPAC name is N-(4-benzo[i][1,5]benzodiazepin-1-ylphenyl)pyridine-3-carboxamide.
| Compound Name | N-(4-benzo[i][1,5]benzodiazepin-1-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141368428 |
| Molecular Formula | C25H18N4O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(4-benzo[i][1,5]benzodiazepin-1-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2C=CC=Nc3ccc4ccccc4c32)cc1)c1cccnc1 |
| InChI | InChI=1S/C25H18N4O/c30-25(19-6-3-14-26-17-19)28-20-9-11-21(12-10-20)29-16-4-15-27-23-13-8-18-5-1-2-7-22(18)24(23)29/h1-17H,(H,28,30) |
| InChIKey | WEDLWLWYROOFQB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |