C24H28F3NO — CID 141369414
(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-(3-ethylphenyl)ethanimine (PubChem CID 141369414) has the molecular formula C24H28F3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-(3-ethylphenyl)ethanimine.
| Compound Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-(3-ethylphenyl)ethanimine |
|---|---|
| PubChem CID | 141369414 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-(3-ethylphenyl)ethanimine |
| SMILES | CCc1cccc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H28F3NO/c1-3-18-8-7-11-21(14-18)17(2)28-29-16-19-12-13-22(20-9-5-4-6-10-20)23(15-19)24(25,26)27/h7-8,11-15,20H,3-6,9-10,16H2,1-2H3/b28-17+ |
| InChIKey | HNGXZQXJQKMRGL-OGLMXYFKSA-N |
| XLogP | 7.26 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|