About copper;1-(2-methylphenyl)triazole
copper;1-(2-methylphenyl)triazole (PubChem CID 141369525) has the molecular formula C9H9CuN3
and a molecular weight of 222.74 g/mol. Its IUPAC name is copper;1-(2-methylphenyl)triazole.
Molecular Properties
| Compound Name | copper;1-(2-methylphenyl)triazole |
| PubChem CID | 141369525 |
| Molecular Formula | C9H9CuN3 |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | copper;1-(2-methylphenyl)triazole |
| SMILES | Cc1ccccc1-n1ccnn1.[Cu] |
| InChI | InChI=1S/C9H9N3.Cu/c1-8-4-2-3-5-9(8)12-7-6-10-11-12;/h2-7H,1H3; |
| InChIKey | TZCHNXKXIHPKIK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze copper;1-(2-methylphenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1-(2-methylphenyl)triazole?
The IUPAC name of copper;1-(2-methylphenyl)triazole (CID 141369525) is copper;1-(2-methylphenyl)triazole.
What is the SMILES notation for copper;1-(2-methylphenyl)triazole?
The canonical SMILES for copper;1-(2-methylphenyl)triazole is Cc1ccccc1-n1ccnn1.[Cu].
What is the InChIKey of copper;1-(2-methylphenyl)triazole?
The InChIKey is TZCHNXKXIHPKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.Cu/c1-8-4-2-3-5-9(8)12-7-6-10-11-12;/h2-7H,1H3;.
What are the key properties of copper;1-(2-methylphenyl)triazole?
copper;1-(2-methylphenyl)triazole has a molecular weight of 222.74 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1-(2-methylphenyl)triazole is sourced from PubChem (CID 141369525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).