C43H27Cl2N5 — CID 141374002
2,3-dichloro-5,10,15-triphenyl-20-pyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 141374002) has the molecular formula C43H27Cl2N5 and a molecular weight of 684.63 g/mol. Its IUPAC name is 2,3-dichloro-5,10,15-triphenyl-20-pyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 2,3-dichloro-5,10,15-triphenyl-20-pyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141374002 |
| Molecular Formula | C43H27Cl2N5 |
| Molecular Weight | 684.63 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | 2,3-dichloro-5,10,15-triphenyl-20-pyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | Clc1c(Cl)c2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccncc2)C=C3)C=C1 |
| InChI | InChI=1S/C43H27Cl2N5/c44-40-41(45)43-39(29-22-24-46-25-23-29)35-21-19-33(49-35)37(27-12-6-2-7-13-27)31-17-16-30(47-31)36(26-10-4-1-5-11-26)32-18-20-34(48-32)38(42(40)50-43)28-14-8-3-9-15-28/h1-25,47,50H/b36-30-,36-32-,37-31-,37-33-,38-34-,39-35-,42-38-,43-39- |
| InChIKey | WDIUNINNPCZEOK-DFAQTAGESA-N |
| XLogP | 12.03 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.63 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |