C12H20N2 — CID 141374044
3-[(2-methylpyrrol-1-yl)methyl]cyclohexan-1-amine (PubChem CID 141374044) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-[(2-methylpyrrol-1-yl)methyl]cyclohexan-1-amine.
| Compound Name | 3-[(2-methylpyrrol-1-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 141374044 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-[(2-methylpyrrol-1-yl)methyl]cyclohexan-1-amine |
| SMILES | Cc1cccn1CC1CCCC(N)C1 |
| InChI | InChI=1S/C12H20N2/c1-10-4-3-7-14(10)9-11-5-2-6-12(13)8-11/h3-4,7,11-12H,2,5-6,8-9,13H2,1H3 |
| InChIKey | XWNZDYBHCYLDFE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |