C31H29Cl3O2Sn — CID 141374138
tris[(2-chlorophenyl)methyl]stannyl 2,4,6-trimethylbenzoate (PubChem CID 141374138) has the molecular formula C31H29Cl3O2Sn and a molecular weight of 658.64 g/mol. Its IUPAC name is tris[(2-chlorophenyl)methyl]stannyl 2,4,6-trimethylbenzoate.
| Compound Name | tris[(2-chlorophenyl)methyl]stannyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 141374138 |
| Molecular Formula | C31H29Cl3O2Sn |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 658.03 |
| IUPAC Name | tris[(2-chlorophenyl)methyl]stannyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)O[Sn](Cc2ccccc2Cl)(Cc2ccccc2Cl)Cc2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C10H12O2.3C7H6Cl.Sn/c1-6-4-7(2)9(10(11)12)8(3)5-6;3*1-6-4-2-3-5-7(6)8;/h4-5H,1-3H3,(H,11,12);3*2-5H,1H2;/q;;;;+1/p-1 |
| InChIKey | DFRVBBSCALWOGC-UHFFFAOYSA-M |
| XLogP | 9.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |