C12H20N4 — CID 141374966
4-N-cyclohexyl-5,6-dimethylpyrimidine-2,4-diamine (PubChem CID 141374966) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-N-cyclohexyl-5,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-5,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141374966 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-N-cyclohexyl-5,6-dimethylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(NC2CCCCC2)c1C |
| InChI | InChI=1S/C12H20N4/c1-8-9(2)14-12(13)16-11(8)15-10-6-4-3-5-7-10/h10H,3-7H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | UUCMYPQOEOVRGH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |