C9H20O6Si — CID 141376175
2,3-dihydroxy-1-triethoxysilylpropan-1-one (PubChem CID 141376175) has the molecular formula C9H20O6Si and a molecular weight of 252.34 g/mol. Its IUPAC name is 2,3-dihydroxy-1-triethoxysilylpropan-1-one.
| Compound Name | 2,3-dihydroxy-1-triethoxysilylpropan-1-one |
|---|---|
| PubChem CID | 141376175 |
| Molecular Formula | C9H20O6Si |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,3-dihydroxy-1-triethoxysilylpropan-1-one |
| SMILES | CCO[Si](OCC)(OCC)C(=O)C(O)CO |
| InChI | InChI=1S/C9H20O6Si/c1-4-13-16(14-5-2,15-6-3)9(12)8(11)7-10/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | DORICFBJHQJOLH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|