C10H24O7Si — CID 141292776
3,4-dihydroxy-1-triethoxysilylbutan-2-one;hydrate (PubChem CID 141292776) has the molecular formula C10H24O7Si and a molecular weight of 284.38 g/mol. Its IUPAC name is 3,4-dihydroxy-1-triethoxysilylbutan-2-one;hydrate.
| Compound Name | 3,4-dihydroxy-1-triethoxysilylbutan-2-one;hydrate |
|---|---|
| PubChem CID | 141292776 |
| Molecular Formula | C10H24O7Si |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3,4-dihydroxy-1-triethoxysilylbutan-2-one;hydrate |
| SMILES | CCO[Si](CC(=O)C(O)CO)(OCC)OCC.O |
| InChI | InChI=1S/C10H22O6Si.H2O/c1-4-14-17(15-5-2,16-6-3)8-10(13)9(12)7-11;/h9,11-12H,4-8H2,1-3H3;1H2 |
| InChIKey | RFKZBPAJVUSISS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|