C15H15N3O — CID 141378131
(E)-4-[1-(3-phenylprop-2-enyl)triazol-4-yl]but-3-en-2-one (PubChem CID 141378131) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is (E)-4-[1-(3-phenylprop-2-enyl)triazol-4-yl]but-3-en-2-one.
| Compound Name | (E)-4-[1-(3-phenylprop-2-enyl)triazol-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 141378131 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (E)-4-[1-(3-phenylprop-2-enyl)triazol-4-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cn(CC=Cc2ccccc2)nn1 |
| InChI | InChI=1S/C15H15N3O/c1-13(19)9-10-15-12-18(17-16-15)11-5-8-14-6-3-2-4-7-14/h2-10,12H,11H2,1H3/b8-5?,10-9+ |
| InChIKey | UGTSLXMSJQYMLS-SSJUCLBWSA-N |
| XLogP | 2.59 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|